Malaoxon
From Wikipedia, the free encyclopedia
| Malaoxon | |
|---|---|
 |
|
| IUPAC name | 2-(dimethoxyphosphorylthio) butanedioic acid diethyl ester |
| Identifiers | |
| CAS number | |
| PubChem | |
| SMILES | CCOC(=O)CC(C(=O)OCC)SP(=O)(OC)OC |
| Properties | |
| Molecular formula | C10H19O7PS |
| Molar mass | 314.292421 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Malaoxon is a breakdown product of malathion. It is more toxic than malathion.
 |
This biochemistry article is a stub. You can help Wikipedia by expanding it. |
