Lithium bis(trimethylsilyl)amide
From Wikipedia, the free encyclopedia
| Lithium bis(trimethylsilyl)amide | |
|---|---|
 |
|
| IUPAC name | lithium bis(trimethylsilyl)azanide |
| Other names | Lithium bis(trimethylsilyl)amide |
| Identifiers | |
| CAS number | [4039-32-1] |
| SMILES | C[Si](C)(C)[N-][Si](C)(C)C.[Li+] |
| Properties | |
| Molecular formula | C6H18LiNSi2 |
| Molar mass | 167.326 g/mol |
| Hazards | |
| Main hazards | flammable |
| Related compounds | |
| Related compounds | Sodium bis(trimethylsilyl)amide, Potassium bis(trimethylsilyl)amide |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Lithium bis(trimethylsilyl)amide is the chemical compound with the formula ((CH3)3Si)2NLi. This compound, often called lithium hexamethyldisilazide or LiHMDS, is a strong base used for deprotonation reactions.
[edit] See also
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
