Laquinimod
From Wikipedia, the free encyclopedia
| Laquinimod | |
|---|---|
 |
|
| IUPAC name | 5-chloro-N-ethyl-4-hydroxy-1-methyl-2-oxo- N-phenyl-1,2-dihydroquinoline-3-carboxamide |
| Identifiers | |
| CAS number | [248282-07-7] |
| PubChem | |
| SMILES | CCN(c1ccccc1)C(=O)C\3=C(/O)c2c(Cl)cccc2N(C)C/3=O |
| Properties | |
| Molecular formula | C19H17ClN2O3 |
| Molar mass | 356.803 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Laquinimod is an immunomodulator developed by Active Biotech and produced by Teva Pharmaceutical Industries. It is currently under development in phase III trials for treatment of multiple sclerosis as an oral therapy, like fingolimod.
 |
This pharmacology-related article is a stub. You can help Wikipedia by expanding it. |
