L-selectride
From Wikipedia, the free encyclopedia
| L-selectride | |
|---|---|
 |
|
| IUPAC name | lithium tri-sec-butyl(hydrido)borate(1-) |
| Identifiers | |
| CAS number | [38721-52-7] |
| SMILES | [Li+].CCC(C)[BH-](C(C)CC)C(C)CC |
| Properties | |
| Molecular formula | C12H28BLi |
| Molar mass | 190.10 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
L-selectride, is an organic compound. It is used in organic chemistry as a reducing agent, for example in the reduction of a ketone, as part of Overman's synthesis of strychnine.[1]
N-selectride and K-selectride is the same compound but instead of lithium as cation they have sodium and potassium cations respectively.
[edit] References
- ^ S. D. Knight, L. E. Overman and G. Pairaudeau (1993). "Synthesis applications of cationic aza-Cope rearrangements. 26. Enantioselective total synthesis of (-)-strychnine". J. Am. Chem. Soc. 115 (20): 9293–9294. doi:.
