Isoxathion
From Wikipedia, the free encyclopedia
| Isoxathion | |
|---|---|
 |
|
| IUPAC name | Diethoxy-[(5-phenyl-3-isoxazolyl)oxy]-thioxophosphorane |
| Other names | •O,O-Diethyl O-5-phenyl-1,2-oxazol-3-yl phosphorothioate •O,O-Diethyl O-(5-phenyl-3-isoxazolyl) phosphorothioate |
| Identifiers | |
| CAS number | [18854-01-8] |
| PubChem | |
| SMILES | S=P(OCC)(OCC)OC1=NOC(c2ccccc2)=C1 |
| Properties | |
| Molecular formula | C13H16NO4PS |
| Molar mass | 313.31 g/mol |
| Appearance | Yellowish liquid |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Isoxathion is a molecular chemical with the molecular formula C13H16NO4PS. It is an insecticide, specifically an isoxazole organothiophosphate insecticide.
[edit] External links
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
