Isomalathion
From Wikipedia, the free encyclopedia
| Isomalathion | |
|---|---|
 |
|
| IUPAC name | diethyl 2-(methoxy-methylsulfanylphosphoryl)sulfanylbutanedioate |
| Other names | S-Methylmalathion |
| Identifiers | |
| CAS number | |
| PubChem | |
| SMILES | CCOC(=O)CC(C(=O)OCC)SP(=O)(OC)SC |
| Properties | |
| Molecular formula | C10H19O6PS2 |
| Molar mass | 330.358021 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Isomalathion is an impurity found in malathion.
 |
This biochemistry article is a stub. You can help Wikipedia by expanding it. |
