Iprodione
From Wikipedia, the free encyclopedia
| Iprodione | |
|---|---|
 |
|
| IUPAC name | 3-(3,5-dichlorophenyl)-N-isopropyl-2,4-dioxo-1-imidazolidinecarboxamide |
| Other names | Glycophene Promidione |
| Identifiers | |
| CAS number | [36734-19-7] |
| PubChem | |
| SMILES | CC(C)NC(=O)N1CC(=O)N(C1=O)C2=CC(=CC(=C2)Cl)Cl |
| Properties | |
| Molecular formula | C13H13Cl2N3O3 |
| Molar mass | 330.16662 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Iprodione is a imidazole fungicide.
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
