Hydroxystilbamidine
From Wikipedia, the free encyclopedia
| Hydroxystilbamidine | |
|---|---|
 |
|
| IUPAC name | 4-[(E)-2-(4-carbamimidoylphenyl)ethenyl]- 3-hydroxybenzenecarboximidamide |
| Identifiers | |
| CAS number | [495-99-8] |
| PubChem | |
| SMILES | Oc2cc(ccc2/C=C/c1ccc(cc1)C(N)=N)C(N)=N |
| Properties | |
| Molecular formula | C16H16N4O |
| Molar mass | 280.324 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Hydroxystilbamidine (trade name FluoroGold) is a fluorescent dye that emits different frequencies of light when bound to DNA and RNA. It is used as a retrograde tracer for outlining neurons, and as a histochemical stain.
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
