Hydroxynaphthol blue
From Wikipedia, the free encyclopedia
| Hydroxynaphthol blue | |
|---|---|
 |
|
| Other names | Hydroxynaphthol blue |
| Identifiers | |
| CAS number | [63451-35-4] |
| PubChem | |
| SMILES | O=S(C(C=C4)=CC1=C4C(/N=N/C2=C3C(C=CC=C3)=C(S(=O)(O[Na])=O)C=C2O)=C(O)C(S(=O)(O[Na])=O)=C1)(O[Na])=O |
| Properties | |
| Molecular formula | C20H11N2Na3O11S3 |
| Molar mass | 620.46301 g/mol |
| Appearance | Black-violet Powder |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Hydroxynaphthol blue is an azo dye.
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
