Hexanitroethane
From Wikipedia, the free encyclopedia
| Hexanitroethane | |
|---|---|
 |
|
| IUPAC name | 1,1,1,2,2,2-Hexanitroethane |
| Identifiers | |
| CAS number | [918-37-6] |
| PubChem | |
| EINECS number | |
| SMILES | C(C([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-])([N+](=O)[O-])([N+](=O)[O-])[N+](=O)[O-] |
| Properties | |
| Molecular formula | C2N6O12 |
| Molar mass | 300.0544 |
| Melting point |
135 °C, 408 K, 275 °F |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Hexanitroethane (HNE) is an organic compound with chemical formula C2N6O12 or (O2N)3C-C(NO2)3. It is a solid matter with a melting point of 135 °C.
Hexanitroethane is used in some pyrotechnic compositions as a nitrogen-rich oxidizer, e.g. in some decoy flare compositions and some propellants. Like hexanitrobenzene, HNE is investigated as a gas source for explosively pumped gas dynamic laser.
A composition of HNE as oxidizer with boron as fuel is being investigated as a new explosive.[1]
[edit] See also
- Tetranitromethane
- Trinitromethane
