HEPPS (buffer)
From Wikipedia, the free encyclopedia
| HEPPS | |
|---|---|
 |
|
| IUPAC name | 3-[4-(2-hydroxyethyl)piperazin-1-yl]propane-1-sulfonic acid |
| Other names | HEPPS, EPPS |
| Identifiers | |
| CAS number | |
| SMILES | C1CN(CCN1CCCS(=O)(=O)O)CCO |
| Properties | |
| Molecular formula | C9H20N2O4S |
| Molar mass | 252.332 g/mol |
| Density | g/cm3 |
| Melting point |
(dec.) |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
HEPPS or EPPS are the common names for the compound 3-[4-(2-Hydroxyethyl)-1-piperazinyl]propanesulfonic acid. It is used as a buffering agent in biology and biochemistry. Its chemical structure contains a piperazine ring. The pKa of HEPPS is 8.00.
[edit] See also
 |
This biochemistry article is a stub. You can help Wikipedia by expanding it. |
