Hawkinsin
From Wikipedia, the free encyclopedia
| Hawkinsin | |
|---|---|
| IUPAC name | 2-Amino-3-[[2-(carboxymethyl)-2,5-dihydroxy-1-cyclohex-3-enyl]sulfanyl]propanoic acid |
| Other names | (2-L-Cystein-S-yl-1,4-dihydroxycyclohex-5-en-1-yl)acetic acid |
| Identifiers | |
| CAS number | [63224-90-8] |
| PubChem | |
| SMILES | C1C(C=CC(C1SCC(C(=O)O)N)(CC(=O)O)O)O |
| Properties | |
| Molecular formula | C11H17NO6S |
| Molar mass | 291.32 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Hawkinsin is an amino acid.
It is found in elevated concentrations in the urine in hawkinsinuria.

