GW 501516
From Wikipedia, the free encyclopedia
| GW 501516 | |
|---|---|
 |
|
| Identifiers | |
| CAS number | |
| PubChem | |
| SMILES | O=C(O[H])COc1c(C)cc(SCC2=C(C)N=C(c3ccc(C(F)(F)F)cc3)S2)cc1 |
| Properties | |
| Molecular formula | C21H18F3NO3S2 |
| Molar mass | 453.49773 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
GW 501516 is a PPAR-delta modulator.[1]
[edit] References
- ^ Dimopoulos N, Watson M, Green C, Hundal HS (2007). "The PPARdelta agonist, GW501516, promotes fatty acid oxidation but has no direct effect on glucose utilisation or insulin sensitivity in rat L6 skeletal muscle cells". FEBS Lett. 581 (24): 4743-8. doi:. PMID 17869249.
[edit] See also
 |
This chemistry article is a stub. You can help Wikipedia by expanding it. |
