Galactose-1-phosphate
From Wikipedia, the free encyclopedia
| Galactose-1-phosphate | |
|---|---|
 |
|
| IUPAC name | [3,4,5-Trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphosphonic acid |
| Identifiers | |
| CAS number | [2255-14-3] |
| PubChem | |
| MeSH | |
| SMILES | C(C1C(C(C(C(O1)OP(=O)(O)O)O)O)O)O |
| Properties | |
| Molecular formula | C6H13O9P |
| Molar mass | 260.136 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Galactose-1-phosphate is an intermediate in the intraconversion of glucose and galactose.
It is formed from galactose by galactokinase.
[edit] See also
 |
This biochemistry article is a stub. You can help Wikipedia by expanding it. |
