Fura-2-acetoxymethyl ester
From Wikipedia, the free encyclopedia
| Fura-2-acetoxymethyl ester | |
|---|---|
 |
|
| IUPAC name | Acetoxymethyl 2-[5-[bis[(acetoxymethoxy-oxo-
methyl)methyl]amino]-4-[2-[2-[bis[(acetoxymethoxy-oxo- methyl)methyl]amino]-5-methyl-phenoxy]ethoxy]benzofuran- 2-yl]oxazole-5-carboxylate |
| Other names | Fura-2AM |
| Identifiers | |
| CAS number | [108964-32-5] |
| PubChem | |
| SMILES | CC1=CC(=C(C=C1)N(CC(=O)OCOC(=O)C)CC(=O)OCOC(=O)C)
OCCOC2=C(C=CC3=C2C=C(O3)C4=NC=C(O4)C(=O)OCOC(=O)C)N (CC(=O)OCOC(=O)C)CC(=O)OCOC(=O)C |
| Properties | |
| Molecular formula | C44H47N3O24 |
| Molar mass | 1001.85 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Fura-2-acetoxymethyl ester, often abbreviated Fura-2AM, is a ratiometric calcium indicator used in biochemistry, measured by changes in fluorescence. Fura-2AM is a membrane-permeable derivative of Fura-2.
Measurement of Ca+2-induced fluorescence at both 340 nm and 380 nm allows for 340/380 ratios. This helps in cancellation of artifacts produced by changes in dye concentrations.
 |
This biochemistry article is a stub. You can help Wikipedia by expanding it. |
