Fumarylacetoacetate
From Wikipedia, the free encyclopedia
| Fumarylacetoacetate | |
|---|---|
 |
|
| IUPAC name | (E)-4,6-dioxooct-2-enedioic acid |
| Identifiers | |
| CAS number | [28613-33-4] |
| PubChem | |
| MeSH | |
| SMILES | C(C(=O)CC(=O)O)C(=O)C=CC(=O)O |
| Properties | |
| Molecular formula | C8H8O6 |
| Molar mass | 200.146 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Fumarylacetoacetate is an intermediate in the metabolism of tyrosine.
[edit] See also
 |
This biochemistry article is a stub. You can help Wikipedia by expanding it. |
