Fucitol (data page)
From Wikipedia, the free encyclopedia
| The complete data for Fucitol | ||||||||||||||||
| General information Chemical formula: C6H14O5
Molar mass: 166.172 g·mol-1 Systematic name: hexane-1,2,3,4,5-pentol Synonyms: 1-deoxy-D-altritol 1-deoxy-D-mannitol 1-deoxyhexitol 1-desoxy-D-mannitol 6-desoxy-L-altritol 6-desoxy-L-gulitol |
||||||||||||||||
| Database data | ||||||||||||||||
| SMILES: CC(C(C(C(CO)O)O)O)O InChI=1/C6H14O5/c1-3(8)5(10)6(11)4(9)2-7/h3-11H,2H2,1H3
|
||||||||||||||||
| Physical properties | ||||||||||||||||
|
||||||||||||||||
| Hazard properties | ||||||||||||||||
|
||||||||||||||||
| Chemical properties | ||||||||||||||||
|
||||||||||||||||
| Pharmacological properties | ||||||||||||||||
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) | ||||||||||||||||

