Ferujol
From Wikipedia, the free encyclopedia
| Ferujol | |
|---|---|
 |
|
| IUPAC name | 8-{[(2E)-3,7-dimethyloct-2-en-1-yl]oxy}-7-hydroxy-2H-chromen-2-one |
| Identifiers | |
| CAS number | [98299-78-6] |
| PubChem | |
| SMILES | CC(C)CCCC(=CCOC1=C(C=CC2=C1OC(=O)C=C2)O)C |
| Properties | |
| Molecular formula | C19H24O4 |
| Molar mass | 316.39146 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Ferujol is a compound in the coumarin family, isolated from Ferula jaeschkeana and reported to have contraceptive activity when given to female rats 1-5 days after coitus.[1]
[edit] References
- ^ Singh MM, Gupta DN, Wadhwa V, Jain GK, Khanna NM, Kamboj VP. (1985) Contraceptive efficacy and hormonal profile of ferujol: a new coumarin from Ferula jaeschkeana. Planta medica 1985 (3):268-270
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
