Ferrous lactate
From Wikipedia, the free encyclopedia
| Ferrous lactate | |
|---|---|
 |
|
| IUPAC name | Ferrous 2-hydroxypropanoate |
| Other names | Iron dilactate Iron(II) lactate E585 |
| Identifiers | |
| CAS number | [5905-52-2] |
| PubChem | |
| SMILES | CC(C(=O)[O-])O.CC(C(=O)[O-])O.[Fe+2] |
| Properties | |
| Molecular formula | C6H10FeO6 |
| Molar mass | 233.99 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Ferrous lactate, or iron(II) lactate, is a chemical compound consisting of one atom of iron (Fe2+) and two lactate anions. It has the chemical formula Fe(C3H5O3)2. It is used as a food additive with E number E585. It is an acidity regulator and colour retention agent, and is also used to fortify foods with iron.
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
