Fenthion
From Wikipedia, the free encyclopedia
| Fenthion | |
|---|---|
 |
|
| IUPAC name | Dimethoxy-[3-methyl-4-(methylthio)phenoxy]-thioxophosphorane |
| Other names | •O,O-Dimethyl O-[3-methyl-4-(methylthio)phenyl] phosphorothioate •O,O-Dimethyl O-4-methylthio-m-tolyl phosphorothioate |
| Identifiers | |
| CAS number | |
| PubChem | |
| SMILES | CC1=C(C=CC(=C1)OP(=S)(OC)OC)SC |
| Properties | |
| Molecular formula | C10H15O3PS2 |
| Molar mass | 278.33 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Fenthion is an organothiophosphate insecticide, which is a subset of the organophosphates. Fenthion's mode of action is via cholinesterase inhibition, i.e., it is a nerve poison for insects.
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
