Fenitrothion
From Wikipedia, the free encyclopedia
| Fenitrothion | |
|---|---|
 |
|
| IUPAC name | Dimethoxy-(3-methyl-4-nitrophenoxy)-thioxophosphorane |
| Other names | •O,O-Dimethyl O-4-nitro-m-tolyl phosphorothioate •O,O-Dimethyl O-(3-methyl-4-nitrophenyl) phosphorothioate |
| Identifiers | |
| CAS number | [122-14-5] |
| PubChem | |
| SMILES | CC1=C(C=CC(=C1)OP(=S)(OC)OC)[N+](=O)[O-] |
| Properties | |
| Molecular formula | C9H12NO5PS |
| Molar mass | 277.234041 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Fenitrothion is an organophosphate insecticide.
The name "MEP" is approved by the Japanese Ministry of Agriculture, Forestry and Fisheries.
[edit] External links
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
