Exatecan
From Wikipedia, the free encyclopedia
| Exatecan | |
|---|---|
 |
|
| IUPAC name | (1S,9S)-1-Amino-9-ethyl-5-fluoro-1,2,3,9,12,15-hexahydro-9-hydroxy-4-methyl-10H,13H-benzo(de)pyrano(3',4':6,7)indolizino(1,2-b)quinoline-10,13-dione |
| Identifiers | |
| CAS number | [171335-80-1] |
| PubChem | |
| SMILES | CCC1(C2=C(COC1=O)C(=O)N3CC4=C5C(CCC6=C5C(=CC(=C6C)F)N=C4C3=C2)N)O |
| Properties | |
| Molecular formula | C24H22FN3O4 |
| Molar mass | 435.447583 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Exatecan is an analogue of camptothecin.
 |
This biochemistry article is a stub. You can help Wikipedia by expanding it. |
