Ethion
From Wikipedia, the free encyclopedia
| Ethion | |
|---|---|
 |
|
| IUPAC name | [(Dethoxyphosphinothioylthio)methylthio]-diethoxy-thioxophosphorane |
| Other names | O,O,O′,O′-Tetraethyl S,S′-methylene bis(phosphorodithioate) |
| Identifiers | |
| CAS number | |
| PubChem | |
| SMILES | CCOP(=S)(OCC)SCSP(=S)(OCC)OCC |
| Properties | |
| Molecular formula | C9H22O4P2S4 |
| Molar mass | 384.48 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Ethion (C9H22O4P2S4) is an organophosphate insecticide.
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
