DMDNB
From Wikipedia, the free encyclopedia
| DMDNB | |
|---|---|
| IUPAC name | 2,3-Dimethyl-2,3-dinitrobutane |
| Other names | 2,3-Dimethyl-2,3-dinitro-n-butane, DMDNB, DMNB |
| Identifiers | |
| CAS number | [3964-18-9] |
| PubChem | |
| SMILES | CC(C)(N(=O)=O)C(C)(C)N(=O)=O |
| InChI | 1/C6H12N2O4/c1-5(2,7(9)10)6(3,4)8(11)12/h1-4H3 |
| Properties | |
| Molecular formula | C6H12N2O4 |
| Molar mass | 176.17 g/mol |
| Melting point |
210 - 214 °C |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
DMDNB, or also DMNB, chemically 2,3-dimethyl-2,3-dinitrobutane, is a volatile organic compound used as a detection taggant for explosives, mostly in the United States where it is virtually the only such taggant in use. Dogs are very sensitive to it and can detect as little as 0.5 parts per billion in the air, as can specialised ion mobility spectrometers. Its presence allows more reliable explosive detection.
Its formula is CH3-C(CH3)(NO2)-C(CH3)(NO2)-CH3.

