Diphthamide
From Wikipedia, the free encyclopedia
| Diphthamide | |
|---|---|
 |
|
| IUPAC name | 2-Amino-3-[2-(3-carbamoyl-3-trimethylammonio-propyl)-3H-imidazol-4-yl]propanoate |
| Identifiers | |
| CAS number | [75645-22-6] |
| PubChem | |
| SMILES | C[N+](C)(C)C(CCC1=NC=C(N1)CC(C(=O)[O-])N)C(=O)N |
| Properties | |
| Molecular formula | C13H23N5O3 |
| Molar mass | 297.35 g mol-1 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Diphthamide is a modified histidine amino acid found in eukaryotic elongation factor 2 (eEF-2). It is ADP-ribosylated by diphtheria toxin, which renders the elongation factor inactive.
 |
This article about a heterocyclic compound is a stub. You can help Wikipedia by expanding it. |
