Diphenylmethane
From Wikipedia, the free encyclopedia
| Diphenylmethane | |
|---|---|
 |
|
| IUPAC name | diphenylmethane |
| Other names | benzylbenzene |
| Identifiers | |
| CAS number | [101-81-5] |
| PubChem | |
| MeSH | |
| SMILES | C1=CC=C(C=C1)CC2=CC=CC=C2 |
| Properties | |
| Molecular formula | C13H12 |
| Molar mass | 168.234 |
| Appearance | colourless oil |
| Density | 1.006 g/mL |
| Melting point |
22-24 °C |
| Boiling point |
264 °C |
| Solubility in water | nonpolar organic solvents |
| Hazards | |
| Main hazards | flammable |
| Flash point | >230 °F |
| Related compounds | |
| Related compounds | Diphenylmethanol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Diphenylmethane is an organic compound with the formula (C6H5)2CH2. The compound consists of methane wherein two hydrogen atoms are replaced by two phenyl groups. It is a building block in organic synthesis.
It is prepared by the reaction of benzyl chloride with benzene in the presence of a Lewis acid such as aluminium trichloride:[1]
- C6H5CH2Cl + C6H6 → (C6H5)2CH2 + HCl
[edit] References
- ^ W. W. Hartman and Ross Phillips (1943). "Diphenylmethane". Org. Synth.; Coll. Vol. 2: 232.
 |
This article about a hydrocarbon is a stub. You can help Wikipedia by expanding it. |
