Diphenylketene
From Wikipedia, the free encyclopedia
| Diphenylketene | |
|---|---|
 |
|
| IUPAC name | 2,2-Di(phenyl)ethenone |
| Other names | Diphenylethenone |
| Identifiers | |
| CAS number | [525-06-4] |
| PubChem | |
| SMILES | C1=CC=C(C=C1)C(=C=O)C2=CC=CC=C2 |
| Properties | |
| Molecular formula | C14H10O |
| Molar mass | 194.2286 |
| Appearance | Red/orange oil |
| Melting point |
8-9 °C |
| Boiling point |
118-120 °C at 1mmHg |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Diphenylketene is a chemical of the ketene family. Diphenylketene, like most disubstituted ketenes is a red/orange oil at room temperature and pressure.
[edit] Chemistry and reactivity
Diphenylketene can undergo nucleophilic attack from a host of nucleophiles, including alcohols, amines, and enolates with fairly slow rates. These rates can be increased in the presence of various catalysts. At present the mechanism of attack is unknown, but various work is underway to determine the exact mechanism.
[edit] Spectroscopic information
1H NMR - Ar protons only (delta shifts between 7 and 8 ppm, showing 1 doublet and two triplets.
UV/vis - Lambda max at 267nm
IR - charicteristic ketene abs. at 2100 cm-1
[edit] References
 |
This article does not cite any references or sources. (October 2007) Please help improve this article by adding citations to reliable sources. Unverifiable material may be challenged and removed. |
