Diphenylchlorarsine
From Wikipedia, the free encyclopedia
| Diphenylchlorarsine | |
|---|---|
 |
|
| IUPAC name | dibenzenidochloridoarsenic, chlorodiphenylarsane |
| Other names | diphenylchlorarsine |
| Identifiers | |
| Abbreviations | Ph2AsCl |
| CAS number | [712-48-1] |
| SMILES | Cl[As](C1=CC=CC=C1)C2=CC=CC=C2 |
| InChI | 1/C12H10AsCl/c14/h1-10H |
| Properties | |
| Molecular formula | C12H10AsCl |
| Molar mass | 264.59 g mol−1 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Diphenylchlorarsine is an odorless harassing agent also known as sneezing gas. It is known to cause sneezing, coughing, headache, salivation, and vomiting. Its chemical formula is (C6H5)2AsCl.
 |
This biochemistry article is a stub. You can help Wikipedia by expanding it. |
