Dioxybenzone
From Wikipedia, the free encyclopedia
| Dioxybenzone | |
|---|---|
 |
|
| IUPAC name | (2-Hydroxy-4-methoxyphenyl)- (2-hydroxyphenyl)methanone |
| Other names | Dioxybenzone benzophenone-8 |
| Identifiers | |
| CAS number | [131-53-3] |
| SMILES | O=C(C2=CC=CC=C2O)C1=C(O)C=C(OC)C=C1 |
| Properties | |
| Molecular formula | C14H12O4 |
| Molar mass | 244.25 g/mol |
| Density | 1.38 g/cm³ |
| Melting point |
68 °C |
| Boiling point |
170-175 °C |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Dioxybenzone is an organic compound used in sunscreen to block UVB. It is a derivative of benzophenone. It is a yellow powder with a melting point of 68 °C. It is insoluble in water, but moderately soluble in ethanol and isopropanol.
[edit] See also
[edit] References
- Merck Index, 12th Edition, 3357.
