Dihydropteroate
From Wikipedia, the free encyclopedia
| Dihydropteroate | |
|---|---|
 |
|
| IUPAC name | 4-{[(2-amino-4-oxo-1,4,7,8-tetrahydropteridin-6-yl)methyl]amino}benzoic acid |
| Molecular formula | C14H14N6O3 |
| Identifiers | |
| CAS number | [2134-76-1] |
| PubChem | |
| KEGG | |
| ChEBI | |
| SMILES | C1C(=NC2=C(N1)NC(=NC2=O)N) CNC3=CC=C(C=C3)C(=O)O |
| Beilstein Reference | 1226443 |
| Properties | |
| Molar mass | 314.3 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Dihydropteroate is a pterin created from para-aminobenzoic acid (PABA) by the enzyme dihydropteroate synthetase. It in an important intermediate in folate synthesis.
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
