Dihydrobiopterin
From Wikipedia, the free encyclopedia
| Dihydrobiopterin | |
|---|---|
 |
|
| IUPAC name | 2-Amino-6-(1,2-dihydroxypropyl)-7,8-dihydro-1H-pteridin-4-one |
| Other names | 7,8-Dihydrobiopterin |
| Identifiers | |
| CAS number | [6779-87-9] |
| PubChem | |
| SMILES | CC(C(C1=NC2=C(NC1)NC(=NC2=O)N)O)O |
| Properties | |
| Molecular formula | C9H13N5O3 |
| Molar mass | 239.23 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Dihydrobiopterin is a compound produced in the synthesis of dopa, dopamine, norepinephrine and epinephrine. It is restored to the required cofactor by dihydrobiopterin reductase.
[edit] See also
 |
This biochemistry article is a stub. You can help Wikipedia by expanding it. |
