Desosamine
From Wikipedia, the free encyclopedia
| Desosamine | |
|---|---|
 |
|
| IUPAC name | (2R,3S,5R)-3-Dimethylamino-2,5-dihydroxyhexanal |
| Identifiers | |
| CAS number | [5779-39-5] |
| PubChem | |
| SMILES | C[C@H](C[C@@H]([C@H](C=O)O)N(C)C)O |
| Properties | |
| Molecular formula | C8H17NO3 |
| Molar mass | 175.23 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Desosamine is a 3-(dimethylamino)-3,4,6-trideoxyhexose found in certain macrolide antibiotics such as the commonly prescribed erythromycin. Six enzymes are required for its biosynthesis in Streptomyces venezuelae.
[edit] References
E. Sethe Burgie, James B. Thoden and Hazel M. Holden. Protein Sci. (2007) 16: 887-896
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
