Dehydrocholic acid
From Wikipedia, the free encyclopedia
| Dehydrocholic acid | |
|---|---|
| IUPAC name | (4R)-4-[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-3,7,12-trioxo-1,2,4,5,6,8,9,11,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
| Identifiers | |
| CAS number | [81-23-2] |
| PubChem | |
| SMILES | C[C@H](CCC(=O)O)[C@H]1CC[C@@H]2[C@@]1(C(=O)C[C@H]3[C@H]2C(=O)C[C@H]4[C@@]3(CCC(=O)C4)C)C |
| Properties | |
| Molecular formula | C24H34O5 |
| Molar mass | 402.52 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Dehydrocholic acid is a synthetic bile acid, manufactured by the oxidation of cholic acid. It acts as a hydrocholeretic, increasing bile output to clear increased bile acid load.[1]
[edit] References
- ^ Yousef IM, Barnwell SG, Tuchweber B, Weber A, Roy CC (1987). "Effect of complete sulfation of bile acids on bile formation in rats". Hepatology 7 (3): 535–42. PMID 3570165.

