Cymene
From Wikipedia, the free encyclopedia
| Cymene | |
|---|---|
 |
|
| IUPAC name | 1-methyl-4-(1-methylethyl)benzene |
| Other names | 4-isopropyltoluene |
| Identifiers | |
| CAS number | [99-87-6] |
| PubChem | |
| EINECS number | |
| SMILES | CC(C)c1ccc(C)cc1 |
| InChI | InChI=1/C10H14/c1-8(2)10-6-4-9
(3)5-7-10/h4-8H,1-3H3 |
| Properties | |
| Molecular formula | C10H14 |
| Molar mass | 134.21 g/mol |
| Appearance | Colourless liquid |
| Density | 0.857 g/cm3 |
| Melting point |
-68°C |
| Boiling point |
177°C |
| Solubility in water | Negligible |
| Hazards | |
| R-phrases | R10 |
| S-phrases | S16 |
| Flash point | 47°C |
| Autoignition temperature |
435°C |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Cymene, or p-cymene, is a naturally occurring aromatic organic compound. It is classified as a hydrocarbon related to a monoterpene. Its structure consists of a benzene ring para-substituted with a methyl group and an isopropyl group. It is insoluble in water, but miscible with ethanol and ether.
Cymene is a constituent of a number of essential oils, most commonly the oil of cumin and thyme.
There are two less common geometric isomers. o-Cymene, in which the alkyl groups are ortho-substituted, and m-cymene, in which they are meta-substituted. p-Cymene is the only natural isomer.
Cymene is a common ligand for ruthenium. The parent compound is [(η6-cymene)MCl2]2. This half-sandwich compound is prepared by the reaction of ruthenium trichloride with the terpene α-phellandrene. The osmium complex is also known.[1]
[edit] References
- ^ Bennett, M. A.; Huang, T. N.; Matheson, T. W. and Smith, A. K. (1982). "(h6-Hexamethylbenzene)ruthenium complexes". Inorganic Syntheses 21: 74–8. doi:.
