CNQX
From Wikipedia, the free encyclopedia
| CNQX | |
|---|---|
| IUPAC name | 7-nitro-2,3-dioxo-1,4-
dihydroquinoxaline-6-carbonitrile |
| Identifiers | |
| CAS number | |
| PubChem | |
| SMILES | C1=C(C(=CC2=C1NC(=O)C(=O)N2)[N+](=O)[O-])C#N |
| Properties | |
| Molecular formula | C9H4N4O4 |
| Molar mass | 232.153 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
CNQX (6-cyano-7-nitroquinoxaline-2,3-dione) is a competitive AMPA/kainate receptor antagonist. Its chemical formula is C9H4N4O4.

