Clomazone
From Wikipedia, the free encyclopedia
| Clomazone | |
|---|---|
 |
|
| IUPAC name | 2-[(2-chlorophenyl)methyl]-4,4-dimethyl-3-isoxazolidinone |
| Other names | Dimethazone |
| Identifiers | |
| CAS number | |
| PubChem | |
| SMILES | CC1(CON(C1=O)CC2=CC=CC=C2Cl)C |
| Properties | |
| Molecular formula | C12H14ClNO2 |
| Molar mass | 239.69806 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Clomazone is an agricultural herbicide, and has been the active ingredient of products named "Command" and "Commence".
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
