Clofibric acid
From Wikipedia, the free encyclopedia
| Clofibric acid | |
|---|---|
 |
|
| IUPAC name | 2-(4-Chlorophenoxy)-2-methylpropanoic acid |
| Other names | Clofibrin Chlorofibrinic acid |
| Identifiers | |
| CAS number | [882-09-7] |
| PubChem | |
| SMILES | CC(C)(C(=O)O)OC1=CC=C(C=C1)Cl |
| Properties | |
| Molecular formula | C10H11ClO3 |
| Molar mass | 214.645 g/mol |
| Appearance | White to yellow solid |
| Melting point |
118-123 °C |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Clofibric acid is a lipid regulator with the chemical formula C10H11ClO3.
[edit] External links
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
