Cladinose
From Wikipedia, the free encyclopedia
| Cladinose | |
|---|---|
 |
|
| IUPAC name | (4R,5S,6S)-4-Methoxy-4,6-dimethyl-tetrahydropyran-2,5-diol |
| Identifiers | |
| CAS number | [470-12-2] |
| PubChem | |
| SMILES | C[C@H]1[C@@H]([C@](CC(O1)O)(C)OC)O |
| Properties | |
| Molecular formula | C8H16O4 |
| Molar mass | 176.21 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Cladinose is a hexose deoxy sugar that in several antibiotics (such as erythromycin) is attached to the macrolide ring.
In ketolides, a relatively new class of antibiotics, the cladinose is replaced with a keto group.
[edit] External links
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
