Cinoxate
From Wikipedia, the free encyclopedia
| Cinoxate[1] | |
|---|---|
 |
|
| IUPAC name | 2-Ethoxyethyl 3-(4- methoxyphenyl)propenoate |
| Other names | Cinoxate 2-Ethoxyethyl p-methoxycinnamate |
| Identifiers | |
| CAS number | [104-28-9] |
| SMILES | O=C(OCCOCC)/C=C/C1=CC=C(OC)C=C1 |
| Properties | |
| Molecular formula | C14H18O4 |
| Molar mass | 250.28 g/mol |
| Density | 1.102 g/cm3 |
| Melting point |
-25 °C |
| Boiling point |
184-187 °C at 2 mmHg |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Cinoxate is an organic compound used as an ingredient in some types of sunscreens. It is an ester formed from methoxycinnamic acid and 2-ethoxyethanol. It is a slightly yellow viscous liquid that is insoluble in water, but miscible with alcohols, esters, and vegetable oils.
It protects skin against the sun by absorbing UV-A and UV-B rays.
[edit] See also
- Octyl methoxycinnamate, another methoxycinnamate-based sunscreen
[edit] References
- ^ Merck Index, 11th Edition, 2312.
