Chromotropic acid
From Wikipedia, the free encyclopedia
| Chromotropic acid | |
|---|---|
 |
|
| IUPAC name | 4,5-dihydroxynaphthalene-2,7-disulfonic acid[1] |
| Identifiers | |
| CAS number | [148-25-4] |
| SMILES | OS(=O)(=O)c1cc(O)c2cc(O)cc(c2c1)S(O)(=O)=O |
| Properties | |
| Molecular formula | C10H8O8S2 |
| Molar mass | 320.30 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Chromotropic acid has the formula is (HO)2C10H4(SO3H)2.
It can be used for as a reagent in the quantitative determination of the systemic herbicide, 2,4-Dichlorophenoxyacetic acid.[2]
The usefulness of this reagent in quantitative determination is the formation of a red colouration (peaking at 580 nm wavelength) when chromotropic acid in 75% sulfuric acid reacts with formaldehyde. The colouration is specific to this aldehyde and is not produced from other organic species such as ketones and carboxylic acids.
[edit] References
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
