Chromomycin A3
From Wikipedia, the free encyclopedia
| Chromomycin A3 | |
|---|---|
| IUPAC name | [(2R,3R,4R,6S)-6-[[(6S,7S)-6-[(2S,4R,5S,6R)- 4-[(2S,4R,5R,6R)-4-[(2R,4S,5S,6S)-5-Acetyloxy-4-hydroxy- 4,6-dimethyl-oxan-2-yl]oxy-5-hydroxy-6-methyl-oxan-2-yl] oxy-5-hydroxy-6-methyl-oxan-2-yl]oxy-7-[(1S,3S,4R)- 3,4-dihydroxy-1-methoxy-2-oxo-pentyl]-4,10-dihydroxy- 3-methyl-5-oxo-7,8-dihydro-6H-anthracen-2-yl] oxy]-4-[(2R,4R,5R,6R)-4-hydroxy-5-methoxy- 6-methyl-oxan-2-yl]oxy-2-methyl-oxan-3-yl] acetate |
| Other names | Chromomycin A3 Toyomycin |
| Molecular formula | C57H82O26 |
| Identifiers | |
| CAS number | [7059-24-7] |
| PubChem | |
| SMILES | C[C@@H]1[C@H]([C@@H](C[C@@H](O1)O[C@H]2 [C@@H](CC3=C(C2=O)C(=C4C(=C3)C=C(C(=C4O) C)O[C@H]5C[C@H]([C@H]([C@H](O5)C)OC(=O) C)O[C@@H]6C[C@H]([C@H]([C@H](O6)C)OC)O)O) [C@@H](C(=O)[C@H]([C@@H](C)O)O)OC)O[C@H]7C [C@H]([C@@H]([C@H](O7)C)O)O[C@H]8C[C@] ([C@H]([C@@H](O8)C)OC(=O)C)(C)O)O |
| Properties | |
| Molar mass | 1183.3 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Chromomycin A3 is a glycosidic antibiotic produced at the fermentation of a strain of Streptomyces griseus. It is also called toyomycin.
[edit] Uses
- Membrane-impermeant G/C-specific fluorescent DNA-binding dye.
- Antibacterial antibiotic.
- Antitumor antibiotic that inhibits RNA synthesis, especially in solid tumors
- Attention: actual medical use is unknown.
|
|||||||||||||||||

