Cholesteryl nonanoate
From Wikipedia, the free encyclopedia
| Cholesteryl nonanoate | |
|---|---|
 |
|
| IUPAC name | [10,13-dimethyl-17-(6-methylheptan-2-yl)- 2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro- 1H-cyclopenta[a]phenanthren-3-yl] nonanoate |
| Other names | Cholesteryl nonanoate, cholesteryl pelargonate, 3β-cholest-5-en-3-ol nonaoate, cholest-5-ene-3-β-yl nonanoate |
| Identifiers | |
| CAS number | [1182-66-7] |
| PubChem | |
| EINECS number | |
| SMILES | C[C@H](CCCC(C)C)[C@H]4CC[C@@]3([H]) [C@]2([H])CC=C1C[C@@H](OC(CCCCCCCC) =O)CC[C@@](C)1[C@]([H])2CC[C@@]34C |
| Properties | |
| Molecular formula | C36H62O2 |
| Appearance | White crystals |
| Melting point |
77 - 82 °C |
| Solubility in water | Insoluble |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Cholesteryl nonanoate, also called cholesteryl pelargonate, 3β-cholest-5-en-3-ol nonaoate or cholest-5-ene-3-β-yl nonanoate, is an ester of cholesterol and nonanoic acid. It is a liquid crystal material forming cholesteric liquid crystals with helical structure. It forms beautiful spherulite crystals.[1]
[edit] Uses
It is used in some hair colors[2], make-ups, and some other cosmetic preparations[3]. It is also used in some pleochroic dyes and together with eg. cholesteryl oleyl carbonate and cholesteryl benzoate in some thermochromic applications[4].
It can be also used as a component of the liquid crystals used for liquid crystal displays.
