Cholane
From Wikipedia, the free encyclopedia
| 5β-Cholane | |
|---|---|
| IUPAC name | (5S,8R,9S,10S,13R,14S,17R)-10,13-Dimethyl-17-[(1R)-1-methylbutyl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene |
| Identifiers | |
| CAS number | [80373-86-0] |
| PubChem | |
| SMILES | CCC[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@H]4[C@@]3(CCCC4)C)C |
| Properties | |
| Molecular formula | C24H42 |
| Molar mass | 330.59 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Cholane is a steroid with a molecular weight of 330.59. It can exist as either of two stereoisomers, 5α-cholane and 5β-cholane.
[edit] See also
[edit] External links
- MeSH Cholanes
- Bellini A, Mencini E, Quaglio M, Guarneri M, Fini A (1991). "Antimicrobial activity of basic cholane derivatives. X. Synthesis of 3 alpha- and 3 beta-amino-5 beta-cholan-24-oic acids". Steroids 56 (7): 395–8. doi:. PMID 1780957.
- Fini A, Fazio G, Roda A, Bellini A, Mencini E, Guarneri M (1992). "Basic cholane derivatives. XI: Comparison between acid and basic derivatives". J Pharm Sci 81 (7): 726–30. doi:. PMID 1403713.
- Roda A, Bellini A, Mencini E, Minutello A, Fini A, Guarneri M (1992). "Effect of basic cholane derivatives on intestinal cholic acid metabolism: in vitro and in vivo activity". J Pharm Sci 81 (3): 237–40. doi:. PMID 1640360.

