Chlortoluron
From Wikipedia, the free encyclopedia
| Chlortoluron | |
|---|---|
 |
|
| IUPAC name | 3-(3-chloro-4-methylphenyl)-1,1-dimethylurea |
| Identifiers | |
| CAS number | |
| PubChem | |
| SMILES | CC1=C(C=C(C=C1)NC(=O)N(C)C)Cl |
| Properties | |
| Molecular formula | C10H13ClN2O |
| Molar mass | 212.67602 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Chlortoluron is a herbicide used to control broadleaf and annual grass weeds in cereal fields.
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
