CGP 52608
From Wikipedia, the free encyclopedia
| CGP 52608 | |
|---|---|
 |
|
| IUPAC name | 3-Methyl-1-[(4-oxo-3-prop-2-enyl-1,3-thiazolidin-2-ylidene)amino]thiourea |
| Identifiers | |
| CAS number | [87958-67-6] |
| PubChem | |
| SMILES | O=C(N/1CC=C)CSC1=N/NC(NC)=S |
| Properties | |
| Molecular formula | C8H12N4OS2 |
| Molar mass | 244.34 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
CGP 52608 is a selective ligand of the RAR-related orphan receptor alpha.[1] CGP 52608 has also been reported to possess antiarthritic activity.[2]
[edit] References
- ^ Wiesenberg I, Missbach M, Kahlen JP, Schräder M, Carlberg C (February 1995). "Transcriptional activation of the nuclear receptor RZR alpha by the pineal gland hormone melatonin and identification of CGP 52608 as a synthetic ligand". Nucleic Acids Res. 23 (3): 327–33. doi:. PMID 7885826.
- ^ Missbach M, Jagher B, Sigg I, Nayeri S, Carlberg C, Wiesenberg I (June 1996). "Thiazolidine diones, specific ligands of the nuclear receptor retinoid Z receptor/retinoid acid receptor-related orphan receptor alpha with potent antiarthritic activity". J. Biol. Chem. 271 (23): 13515–22. doi:. PMID 8662835.
