Carbendazim
From Wikipedia, the free encyclopedia
| Carbendazim[1] | |
|---|---|
 |
|
| IUPAC name | Methyl N-(1H-benzoimidazol-2-yl)carbamate |
| Other names | Mercarzole Carbendazole |
| Identifiers | |
| CAS number | [10605-21-7] |
| PubChem | |
| RTECS number | DD6500000 |
| SMILES | COC(=O)NC1=NC2=CC=CC=C2N1 |
| Properties | |
| Molecular formula | C9H9N3O2 |
| Molar mass | 191.187 g/mol |
| Appearance | Light gray powder |
| Melting point |
302-307 °C (decomposes) |
| Solubility in water | 8 mg/L |
| Acidity (pKa) | 4.48 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Carbendazim is a widely used broad-spectrum benzimidazole fungicide.
[edit] References
- ^ Merck Index, 11th Edition, 1794.
[edit] External links
 |
This agriculture-related article is a stub. You can help Wikipedia by expanding it. |
 |
This article about a heterocyclic compound is a stub. You can help Wikipedia by expanding it. |
