Calcium pyrophosphate
From Wikipedia, the free encyclopedia
| Calcium pyrophosphate | |
|---|---|
 |
|
| IUPAC name | Dicalcium phosphonato phosphate |
| Other names | Calcium diphosphate |
| Identifiers | |
| CAS number | [7790-76-3] |
| PubChem | |
| MeSH | |
| SMILES | [O-]P(=O)([O-])OP(=O)([O-])[O-].[Ca+2].[Ca+2] |
| Properties | |
| Molecular formula | Ca2O7P2 |
| Molar mass | 254.099 |
| Density | 3.09 g/cm3 |
| Melting point |
1230 |
| Solubility in water | Insoluble in cold water |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Calcium pyrophosphate (Ca2O7P2) is a chemical compound that can be formed by the reaction of pyrophosphoric acid and a calcium base or by strongly heating calcium hydrogen orthophosphate or calcium ammonium orthophosphate.
It is commonly used as a mild abrasive agent in toothpastes.
Deposition of CPPD in articular joints causes an arthritis condition called pseudogout.
[edit] See also
 |
This inorganic compound-related article is a stub. You can help Wikipedia by expanding it. |
