Calcium bisulfite
From Wikipedia, the free encyclopedia
| Calcium bisulfite | |
|---|---|
 |
|
| IUPAC name | Calcium hydrogen sulfite |
| Other names | Calcium bisulphite E227 |
| Identifiers | |
| CAS number | |
| PubChem | |
| SMILES | OS(=O)[O-].OS(=O)[O-].[Ca+2] |
| Properties | |
| Molecular formula | CaH2O6S2 |
| Molar mass | 202.22 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Calcium bisulfite (calcium bisulphite) is an inorganic compound which is the salt of calcium cation and bisulfite anion. As a food additive it is used as a preservative under the E number E227.
[edit] See also
 |
This inorganic compound-related article is a stub. You can help Wikipedia by expanding it. |
