Calcium benzoate
From Wikipedia, the free encyclopedia
| Calcium benzoate | |
|---|---|
 |
|
| IUPAC name | calcium dibenzoate |
| Other names | E213 |
| Identifiers | |
| CAS number | [2090-05-3] |
| PubChem | |
| SMILES | C1=CC=C(C=C1)C(=O)[O-].C1=CC=C(C=C1)C(=O)[O-].[Ca+2] |
| Properties | |
| Molecular formula | C14H10CaO4 |
| Molar mass | 282.30 g/mol |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Calcium benzoate is the calcium salt of benzoic acid. It is used in the food industry as a preservative; its E number is E213.
[edit] See also
 |
This article about an organic compound is a stub. You can help Wikipedia by expanding it. |
