Calcitroic acid
From Wikipedia, the free encyclopedia
| Calcitroic acid | |
|---|---|
| IUPAC name | (3R)-3-[(1R,3aR,4E,7aR)-4-[(2Z)-2-[(3R,5R)-3,5-Dihydroxy-2-methylene-cyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]butanoic acid |
| Identifiers | |
| CAS number | |
| PubChem | |
| SMILES | C[C@H](CC(=O)O)[C@H]1CC[C@@H]\2[C@@]1(CCC/C2=C\C=C/3\C[C@@H](C[C@H](C3=C)O)O)C |
| Properties | |
| Molecular formula | C23H34O4 |
| Molar mass | 374.514 |
| Except where noted otherwise, data are given for materials in their standard state (at 25 °C, 100 kPa) Infobox disclaimer and references |
|
Calcitroic acid (1 alpha-hydroxy-23 carboxy-24,25,26,27-tetranorvitamin D(3)) is a metabolite of 1 alpha, 25-dihydroxyvitamin D(3) (calcitriol). It is water soluble, and is excreted in the urine.

